butyryl-CoA
butyryl-CoA structure
|
Common Name | butyryl-CoA | ||
|---|---|---|---|---|
| CAS Number | 2140-48-9 | Molecular Weight | 837.6 | |
| Density | 1.83g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H42N7O17P3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Butyryl-CoA (Chinese name: 但酰辅酶A) has a molecular formula of C25H42N7O17P3S and a molecular weight of 837.6. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | butyryl-CoA |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.83g/cm3 |
|---|---|
| Molecular Formula | C25H42N7O17P3S |
| Molecular Weight | 837.6 |
| Exact Mass | 837.15707506 |
| PSA | 455.28000 |
| LogP | 0.55420 |
| Index of Refraction | 1.7 |
| InChIKey | CRFNGMNYKDXRTN-CITAKDKDSA-N |
| SMILES | CCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 3 | |
CAS#:105-54-4
CAS#:109-21-7
CAS#:18742-94-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [5-(6-aminopurin-9-yl)-2-[[[[3-[2-(2-butanoylsulfanylethylcarbamoyl)ethylcarbamoyl]-3-hydroxy-2,2-dimethyl-propoxy]-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxymethyl]-4-hydroxy-oxolan-3-yl]oxyphosphonic acid |
| Butyryl-CoA |
| butanoyl-CoA |
| S-butyryl-coenzyme-A |
| butyrylcoenzyme A |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of butyryl-CoA? |
| A: CAS number of butyryl-CoA is 2140-48-9. |
| Q: What are the downstream products of butyryl-CoA? |
| A: Related downstream products(CAS) of butyryl-CoA: 105-54-4;109-21-7;18742-94-4. |
| Q: What is the molecular formula of butyryl-CoA? |
| A: Molecular formula of butyryl-CoA is C25H42N7O17P3S. |
| Q: What is the polar surface area (PSA) of butyryl-CoA? |
| A: Polar surface area (PSA) of butyryl-CoA is 455.28000. |
| Q: What is the InChIKey of butyryl-CoA? |
| A: InChIKey of butyryl-CoA is CRFNGMNYKDXRTN-CITAKDKDSA-N. |
| Q: What is the SMILES notation of butyryl-CoA? |
| A: SMILES notation of butyryl-CoA is CCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O. |
| Q: What is the English name of butyryl-CoA? |
| A: The English name of butyryl-CoA is butyryl-CoA. |
| Q: What is the Chinese name of 2140-48-9? |
| A: Chinese name of 2140-48-9 is 2140-48-9. |
| Q: What is the LogP of butyryl-CoA? |
| A: LogP of butyryl-CoA is 0.55420. |
| Q: What are the upstream materials of butyryl-CoA? |
| A: Related upstream materials(CAS) of butyryl-CoA: 85-61-0;106-31-0;4122-54-7;107-92-6;72-89-9;15621-60-0;123-72-8. |