(S,R,S)-AHPC-PEG3-propionic acid structure
|
Common Name | (S,R,S)-AHPC-PEG3-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 2140807-42-5 | Molecular Weight | 662.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H46N4O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S,R,S)-AHPC-PEG3-propionic acid(S,R,S)-AHPC-PEG3-propionic acid is a synthesized E3 ligase ligand-linker conjugate that incorporates the (S,R,S)-AHPC based VHL ligand and 3-unit PEG linker used in PROTAC technology[1]. |
| Name | (S,R,S)-AHPC-PEG3-propionic acid |
|---|
| Description | (S,R,S)-AHPC-PEG3-propionic acid is a synthesized E3 ligase ligand-linker conjugate that incorporates the (S,R,S)-AHPC based VHL ligand and 3-unit PEG linker used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
VHL |
| References |
| Molecular Formula | C32H46N4O9S |
|---|---|
| Molecular Weight | 662.79 |
| InChIKey | YHEJFYORSLEJKX-BEYSDYMESA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)CCOCCOCCOCCC(=O)O)C(C)(C)C)cc1 |
| Hazard Codes | Xi |
|---|