Demethylsuberosin structure
|
Common Name | Demethylsuberosin | ||
|---|---|---|---|---|
| CAS Number | 21422-04-8 | Molecular Weight | 230.259 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 418.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | 134-136℃ | |
| MSDS | N/A | Flash Point | 182.0±21.5 °C | |
Use of DemethylsuberosinDemethylsuberosin (7-Demethylsuberosin) is a coumarin compound isolated from Angelica gigas Nakai, and has anti-inflammatory activity[1]. |
| Name | 7-hydroxy-6-(3-methylbut-2-enyl)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Demethylsuberosin (7-Demethylsuberosin) is a coumarin compound isolated from Angelica gigas Nakai, and has anti-inflammatory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 418.8±45.0 °C at 760 mmHg |
| Melting Point | 134-136℃ |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.259 |
| Flash Point | 182.0±21.5 °C |
| Exact Mass | 230.094299 |
| PSA | 50.44000 |
| LogP | 3.67 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | FIDUIAPDSKSUGO-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1cc2ccc(=O)oc2cc1O |
| HS Code | 2932209090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-demethylsuberosin |
| O-demethylsuberosin |
| Demethylsuberosin |
| 2H-1-Benzopyran-2-one, 7-hydroxy-6-(3-methyl-2-buten-1-yl)- |
| 7-Hydroxy-6-(3-methyl-2-buten-1-yl)-2H-chromen-2-one |
| BEN267 |
| 2H-1-Benzopyran-2-one, 7-hydroxy-6-(3-methyl-2-butenyl)- |
| 7-hydroxy-6-prenylcoumarin |
| 7-demethylsuberosine |