2,5-Dichloro-3-nitropyridine structure
|
Common Name | 2,5-Dichloro-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 21427-62-3 | Molecular Weight | 192.988 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 265.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C5H2Cl2N2O2 | Melting Point | 39-45 °C | |
| MSDS | Chinese USA | Flash Point | 114.2±25.9 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 2,5-Dichloro-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 265.3±35.0 °C at 760 mmHg |
| Melting Point | 39-45 °C |
| Molecular Formula | C5H2Cl2N2O2 |
| Molecular Weight | 192.988 |
| Flash Point | 114.2±25.9 °C |
| Exact Mass | 191.949326 |
| PSA | 58.71000 |
| LogP | 1.89 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | OBUGJYJQJWMOQO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)cnc1Cl |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 36/37/38-22-43 |
| Safety Phrases | S36/37/39-S26 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933399090 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-Dichloro-3-nitropyridine |
| 2,5-dichloro-3-nitro-pyridine |
| 2-amino-5-chloro-3-nitrobenzene |
| T6NJ BG CNW EG |
| 3-nitro-2,5-dichloropyridine |
| 2,5-Dichlor-3-nitro-pyridin |
| MFCD06658963 |
| 2,5-dichloronitropyridine |