2-Amino-5-chloro-3-nitropyridine structure
|
Common Name | 2-Amino-5-chloro-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 5409-39-2 | Molecular Weight | 173.557 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 305.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C5H4ClN3O2 | Melting Point | 193-197 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 138.7±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-5-chloro-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 305.8±37.0 °C at 760 mmHg |
| Melting Point | 193-197 °C(lit.) |
| Molecular Formula | C5H4ClN3O2 |
| Molecular Weight | 173.557 |
| Flash Point | 138.7±26.5 °C |
| Exact Mass | 172.999207 |
| PSA | 84.73000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | GILTXHIJUUIMPI-UHFFFAOYSA-N |
| SMILES | Nc1ncc(Cl)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29333999 |
|
~68%
2-Amino-5-chlor... CAS#:5409-39-2 |
| Literature: Ding, Zi-Chun; Ma, Xiang; Zhou, Weicheng Synthetic Communications, 2012 , vol. 42, # 19 p. 2791 - 2796 |
|
~%
2-Amino-5-chlor... CAS#:5409-39-2 |
| Literature: US5624935 A1, ; |
|
~9%
2-Amino-5-chlor... CAS#:5409-39-2 |
| Literature: Sepiol, Jadwiga; Tomasik, Piotr Acta Chimica Hungarica, 1986 , vol. 121, # 4 p. 333 - 338 |
|
~%
2-Amino-5-chlor... CAS#:5409-39-2 |
| Literature: Zhurnal Russkago Fiziko-Khimicheskago Obshchestva, , vol. 60, p. 689 Chem. Zentralbl., , vol. 99, # II p. 1671 |
|
~%
2-Amino-5-chlor... CAS#:5409-39-2 |
| Literature: Yakugaku Zasshi, , vol. 72, p. 431 Chem.Abstr., , p. 6404 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-pyridinamine, 5-chloro-3-nitro- |
| 5-chloro-3-nitropyridin-2-amine |
| 2-Amino-5-chloro-3-nitrpyridine |
| MFCD00092011 |
| 5-chloro-3-nitro-2-pyridineamine |
| 2-amino-3-nitro-5-chloropyridine |
| 2-PYRIDINAMINE,5-CHLORO-3-NITRO |
| 5-CHLORO-3-NITRO-PYRIDIN-2-YLAMINE |
| 2-Amino-5-chloro-3-nitropyridine |
| 5-Chloro-3-nitro-2-aminopyridine |
| 5-chloro-3-nitro-2-pyridinamine |