(+)-syringaresinol structure
|
Common Name | (+)-syringaresinol | ||
|---|---|---|---|---|
| CAS Number | 21453-69-0 | Molecular Weight | 418.437 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 594.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.5±30.1 °C | |
Use of (+)-syringaresinol(+)-Syringaresinol, a lignan, is a NFAT transcription factor inhibitor, with an IC50 of 329.4 μM. (+)-Syringaresinol also can be used for the research of lymphocytic leukemia[1][2]. |
| Name | (+)-syringaresinol |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-Syringaresinol, a lignan, is a NFAT transcription factor inhibitor, with an IC50 of 329.4 μM. (+)-Syringaresinol also can be used for the research of lymphocytic leukemia[1][2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 329.4 μM (NFAT transcription factor)[1] |
| In Vitro | (+)-Syringaresinol inhibits the growth of P-388 cells, with an ED50 0.41 μg/mL[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 594.7±50.0 °C at 760 mmHg |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.437 |
| Flash Point | 313.5±30.1 °C |
| Exact Mass | 418.162781 |
| PSA | 95.84000 |
| LogP | 0.71 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | KOWMJRJXZMEZLD-HCIHMXRSSA-N |
| SMILES | COc1cc(C2OCC3C(c4cc(OC)c(O)c(OC)c4)OCC23)cc(OC)c1O |
| syringaresinol |
| (+)-(7S,7'S,8R,8'R)-4,4'-dihydroxy-3,3',5,5'-tetramethoxy-7,9':7',9-diepoxylignane |
| 4,4'-(1S,3aR,4S,6aR)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(2,6-dimethoxyphenol) |
| Phenol, 4,4'-[(1S,3aR,4S,6aR)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl]bis[2,6-dimethoxy- |
| (-) Syringaresinol |
| (+)-lirioresinol B |
| (+/-)-syringaresinol |
| 4,4'-(tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl)bis[2,6-dimethoxyphenyl] |