Liriodendrin structure
|
Common Name | Liriodendrin | ||
|---|---|---|---|---|
| CAS Number | 573-44-4 | Molecular Weight | 742.72 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 935.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C34H46O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 519.7±34.3 °C | |
Use of LiriodendrinLiriodendrin is an HSF1 agonist can be isolated from E. ulmoides[1]. |
| Name | Liriodendrin |
|---|---|
| Synonym | More Synonyms |
| Description | Liriodendrin is an HSF1 agonist can be isolated from E. ulmoides[1]. |
|---|---|
| Related Catalog | |
| Target |
HSF1[1] |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 935.7±65.0 °C at 760 mmHg |
| Molecular Formula | C34H46O18 |
| Molecular Weight | 742.72 |
| Flash Point | 519.7±34.3 °C |
| Exact Mass | 742.268433 |
| PSA | 254.14000 |
| LogP | -3.91 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | FFDULTAFAQRACT-XKBSQSBASA-N |
| SMILES | COc1cc(C2OCC3C(c4cc(OC)c(OC5OC(CO)C(O)C(O)C5O)c(OC)c4)OCC23)cc(OC)c1OC1OC(CO)C(O)C(O)C1O |
| Storage condition | ?20°C |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 4-{(1S,3aR,4S,6aR)-4-[4-(β-D-Glucopyranosyloxy)-3,5-dimethoxyphenyl]tetrahydro-1H,3H-furo[3,4-c]furan-1-yl}-2,6-dimethoxyphenyl β-D-glucopyranoside |
| (+)-Syringaresinol di-O-β-glucopyranoside |
| Acanthoside D |
| β-D-Glucopyranoside, 4-[(1R,3aS,4S,6aR)-4-[4-(β-L-glucopyranosyloxy)-3,5-dimethoxyphenyl]tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenyl |
| Liriodendrine |
| Liriodendrin |
| β-D-Glucopyranoside, 4-[(1S,3aR,4S,6aR)-4-[4-(β-D-glucopyranosyloxy)-3,5-dimethoxyphenyl]tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenyl |
| 4-{(1R,3aS,4S,6aR)-4-[4-(β-L-Glucopyranosyloxy)-3,5-dimethoxyphenyl]tetrahydro-1H,3H-furo[3,4-c]furan-1-yl}-2,6-dimethoxyphenyl β-D-glucopyranoside |