Leptophos structure
|
Common Name | Leptophos | ||
|---|---|---|---|---|
| CAS Number | 21609-90-5 | Molecular Weight | 412.06600 | |
| Density | 1.66 g/cm3 | Boiling Point | 444.4ºC at 760 mmHg | |
| Molecular Formula | C13H10BrCl2O2PS | Melting Point | 71-73 °C | |
| MSDS | Chinese USA | Flash Point | >100 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
Use of LeptophosLeptophos is an organophosphate insecticide. |
| Name | leptophos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66 g/cm3 |
|---|---|
| Boiling Point | 444.4ºC at 760 mmHg |
| Melting Point | 71-73 °C |
| Molecular Formula | C13H10BrCl2O2PS |
| Molecular Weight | 412.06600 |
| Flash Point | >100 °C |
| Exact Mass | 409.87000 |
| PSA | 60.36000 |
| LogP | 6.06670 |
| Vapour Pressure | 1.12E-07mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | CVRALZAYCYJELZ-UHFFFAOYSA-N |
| SMILES | COP(=S)(Oc1cc(Cl)c(Br)cc1Cl)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H370-H410 |
| Precautionary Statements | P260-P273-P307 + P311-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | 21-25-39/25-50/53 |
| Safety Phrases | S25-S36/37/39-S45-S60-S61-S23 |
| RIDADR | 2783 |
| RTECS | TB1720000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2930909090 |
|
~%
Leptophos CAS#:21609-90-5 |
| Literature: Synthesis, , # 9 p. 731 - 733 |
|
~%
Leptophos CAS#:21609-90-5 |
| Literature: Synthesis, , # 9 p. 731 - 733 |
|
~%
Leptophos CAS#:21609-90-5 |
| Literature: Synthesis, , # 9 p. 731 - 733 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Structural requirements of organophosphorus insecticides (OPI) to inhibit chicken yolk sac membrane kynurenine formamidase related to OPI teratogenesis.
Environ. Toxicol. Pharmacol. 35(2) , 200-6, (2013) This paper provides new information related to the mechanism of OPI (organophosphorus insecticides) teratogenesis. The COMFA (comparative molecular field analysis) and COMSIA (comparative molecular si... |
|
|
Effects of structure, atropine, and dosing regimen on the delayed neurotoxicity of the insecticide EPN.
Bull. Environ. Contam. Toxicol. 38(2) , 283-8, (1987)
|
|
|
The role of pharmacokinetics and metabolism in species sensitivity to neurotoxic agents.
Fundam. Appl. Toxicol. 6(2) , 190-207, (1986) Attempts have been made to review the role of pharmacokinetics and metabolism in species and age sensitivity as well as the development of various toxic conditions of some neurotoxic chemicals. The ro... |
| LMB |
| CI-940 |
| (Ξ)-[O-(4-bromo-2,5-dichlorophenyl) O-methyl phenylphosphonothioate] |
| O-(4-Bromo-2,5-dichlorophenyl) O-methyl phenylphosphonothioate |
| nk711 |
| MBCP |
| O-(4-bromo-2,5-dichlorophenyl) O-methyl P-phenylphosphonothioate |
| (RS)-(O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphonothioate) |
| PSL |
| Abar |
| EINECS 244-472-8 |
| lepton |
| MFCD06795848 |
| V.C.S. |
| Fosvel |
| LEPTOMYCIN B |