1-Bromo-1H,1H,2H,2H-perfluorodecane structure
|
Common Name | 1-Bromo-1H,1H,2H,2H-perfluorodecane | ||
|---|---|---|---|---|
| CAS Number | 21652-57-3 | Molecular Weight | 527.01600 | |
| Density | 1.758 | Boiling Point | 190ºC | |
| Molecular Formula | C10H4BrF17 | Melting Point | 26ºC | |
| MSDS | N/A | Flash Point | 80ºC | |
| Name | 10-bromo-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.758 |
|---|---|
| Boiling Point | 190ºC |
| Melting Point | 26ºC |
| Molecular Formula | C10H4BrF17 |
| Molecular Weight | 527.01600 |
| Flash Point | 80ºC |
| Exact Mass | 525.92200 |
| LogP | 6.78080 |
| Vapour Pressure | 0.315mmHg at 25°C |
| Index of Refraction | 1.3225 |
| InChIKey | TWWJQNJBBMHHAO-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCBr |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2903799090 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-Perfluorooctyl ethyl bromide |
| 1-bromo-1,1,2,2-tetrahydroperfluorodecane |
| 1-bromo-1h,1h,2h,2h-perfluorodecane |
| 2-(Perfluorooct-1-yl)ethyl bromide |
| 1H,1H,2H,2H-Perfluorodecyl bromide |