2,2-Bis(tert-butylperoxy)butane structure
|
Common Name | 2,2-Bis(tert-butylperoxy)butane | ||
|---|---|---|---|---|
| CAS Number | 2167-23-9 | Molecular Weight | 234.332 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 227.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C12H26O4 | Melting Point | ≥80 °C (SADT) | |
| MSDS | N/A | Flash Point | 70.5±22.5 °C | |
| Name | 2,2-bis(tert-butylperoxy)butane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 227.8±23.0 °C at 760 mmHg |
| Melting Point | ≥80 °C (SADT) |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.332 |
| Flash Point | 70.5±22.5 °C |
| Exact Mass | 234.183105 |
| PSA | 36.92000 |
| LogP | 5.08 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.425 |
| InChIKey | HQOVXPHOJANJBR-UHFFFAOYSA-N |
| SMILES | CCC(C)(OOC(C)(C)C)OOC(C)(C)C |
| Storage condition | Refrigerator (+4°C) + Flammables area |
| Stability | Unstable. Solid material may explode if heated, struck or mixed with other chemicals. Do not grind! Incompatible with acids, bases, strong oxidizing agents, powdered metals, strong reducing agents. |
| Hazard Codes | O: Oxidizing agent;Xi: Irritant; |
|---|---|
| Risk Phrases | R10;R36/38;R7 |
| Safety Phrases | 16-17-26-36/37/39-3/7-14A-14 |
| RIDADR | UN 3103 5.2 |
| WGK Germany | 2 |
| Packaging Group | II |
| Hazard Class | 5.2 |
|
~%
2,2-Bis(tert-bu... CAS#:2167-23-9 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 63, # 3 p. 716 - 720 |
|
~%
2,2-Bis(tert-bu... CAS#:2167-23-9 |
| Literature: Journal of Organic Chemistry USSR (English Translation), , vol. 27, # 4 p. 704 - 706 Zhurnal Organicheskoi Khimii, , vol. 27, # 4 p. 820 - 823 |
|
~%
Detail
|
| Literature: US2537853 , ; |
|
~%
Detail
|
| Literature: US2537853 , ; |
|
~%
Detail
|
| Literature: US2537853 , ; |
|
~%
Detail
|
| Literature: US2537853 , ; |
|
~%
Detail
|
| Literature: US2537853 , ; |
| EINECS 218-507-2 |
| Butane, 2,2-bis(tert-butyldioxy)- |
| Butane, 2,2-bis(tert-butylperoxy)- |
| Chaloxyd P 1293AL |
| Chaloxyd P 1200AL |
| di-tert-butyl 1-methyl-propane-1,1-diyl bis-peroxide |
| 2,2-Bis(tert-butylperoxy)butane |
| 2,2-Di(tert-butylperoxy)butane |
| VP 1200 |
| 2,2-Bis-tert-butylperoxy-butan |
| 2,2-bis-tert-butylperoxy-butane |
| 3,4,6,7-Tetraoxanonane, 5-ethyl-2,2,5,8,8-pentamethyl- |
| MFCD00048243 |
| 2,2-Bis[(2-methyl-2-propanyl)peroxy]butane |