N-(4-(2-bromoacetyl)phenyl)acetamide structure
|
Common Name | N-(4-(2-bromoacetyl)phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 21675-02-5 | Molecular Weight | 256.096 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 433.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.8±23.2 °C | |
| Name | N-[4-(2-bromoacetyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 433.2±25.0 °C at 760 mmHg |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.096 |
| Flash Point | 215.8±23.2 °C |
| Exact Mass | 254.989487 |
| PSA | 46.17000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | BDOHURFEYYDIQE-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)CBr)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925190090 |
|
~90%
N-(4-(2-bromoac... CAS#:21675-02-5 |
| Literature: Park, Chan-Ho; Givens, Richard S. Journal of the American Chemical Society, 1997 , vol. 119, # 10 p. 2453 - 2463 |
|
~%
N-(4-(2-bromoac... CAS#:21675-02-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 6 p. 1773 - 1778 |
|
~%
N-(4-(2-bromoac... CAS#:21675-02-5 |
| Literature: US4423045 A1, ; |
|
~%
N-(4-(2-bromoac... CAS#:21675-02-5 |
| Literature: Journal of Biological Chemistry, , vol. 21, p. 445 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-(4-(2-bromoacetyl)phenyl)acetamide |
| N-[4-(Bromoacetyl)phenyl]acetamide |
| p-acetamidophenacyl bromide |
| 4'-Bromoacetoacetanilide |
| Acetamide, N-[4-(2-bromoacetyl)phenyl]- |