2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid
Modify Date: 2026-07-28 17:38:15
![2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid Structure](https://www.chemsrc.com/extcaspic/465/2171663-97-9.png)
2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid structure
|
Common Name | 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2171663-97-9 | Molecular Weight | 442.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H26N2O5S |
|---|---|
| Molecular Weight | 442.5 |
| InChIKey | CBQQFTSJNUENTH-UHFFFAOYSA-N |
| SMILES | CCC(NC(=O)CSCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid? |
| A: The English name of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid is 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid. |
| Q: What is the InChIKey of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid? |
| A: InChIKey of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid is CBQQFTSJNUENTH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid? |
| A: CAS number of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid is 2171663-97-9. |
| Q: What is the SMILES notation of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid? |
| A: SMILES notation of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid is CCC(NC(=O)CSCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O. |
| Q: What is the Chinese name of 2171663-97-9? |
| A: Chinese name of 2171663-97-9 is 2171663-97-9. |
| Q: What is the molecular formula of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid? |
| A: Molecular formula of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid is C23H26N2O5S. |
| Q: What is the molecular weight of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid? |
| A: Molecular weight of 2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)butanoic acid is 442.5. |