5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione structure
|
Common Name | 5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 21753-16-2 | Molecular Weight | 229.23500 | |
| Density | 1.393g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.23500 |
| Exact Mass | 229.08500 |
| PSA | 73.99000 |
| LogP | 1.57600 |
| Index of Refraction | 1.68 |
| InChIKey | RUUREKIGAKIKIL-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(Cc2c[nH]c3ccccc23)N1 |
|
~%
5-(1H-indol-3-y... CAS#:21753-16-2 |
| Literature: Teng, Xin; Degterev, Alexei; Jagtap, Prakash; Xing, Xuechao; Choi, Sungwoon; Denu, Regine; Yuan, Junying; Cuny, Gregory D. Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 22 p. 5039 - 5044 |
|
~%
5-(1H-indol-3-y... CAS#:21753-16-2 |
| Literature: Elks et al. Journal of the Chemical Society, 1944 , p. 629,631 |
| 5-indol-3-ylmethyl-imidazolidine-2,4-dione |
| hydantoine of DL-tryptophane |
| 5-Indol-3-ylmethyl-imidazolidin-2,4-dion |
| DL-5-indolylmethylhydantoin |