methyl tryptophan structure
|
Common Name | methyl tryptophan | ||
|---|---|---|---|---|
| CAS Number | 7303-49-3 | Molecular Weight | 218.252 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 390.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.0±23.7 °C | |
| Name | Dl-tryptophan, methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.6±27.0 °C at 760 mmHg |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.252 |
| Flash Point | 190.0±23.7 °C |
| Exact Mass | 218.105530 |
| PSA | 68.11000 |
| LogP | 1.19 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | KCUNTYMNJVXYKZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)Cc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2-amino-3-(1H-indol-3-yl)propanoate |
| Methyl tryptophanate |
| 2-Amino-3-(1H-indol-3-yl)-propionic acid methyl ester |
| Tryptophan, methyl ester |
| 2-amino-3-(1H-indol-3-yl)propanoic acid methyl ester |