methyl 2,3-dibromo-3-phenyl-propanoate structure
|
Common Name | methyl 2,3-dibromo-3-phenyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 21770-48-9 | Molecular Weight | 321.99300 | |
| Density | 1.728g/cm3 | Boiling Point | 301.2ºC at 760 mmHg | |
| Molecular Formula | C10H10Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.9ºC | |
| Name | methyl 2,3-dibromo-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.728g/cm3 |
|---|---|
| Boiling Point | 301.2ºC at 760 mmHg |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 321.99300 |
| Flash Point | 135.9ºC |
| Exact Mass | 319.90500 |
| PSA | 26.30000 |
| LogP | 3.05910 |
| Vapour Pressure | 0.00107mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | XPRVBYSCJOFAFY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Br)C(Br)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Antifeedant activity against Hylobius abietis (pine weevil ) in compound pre-treated ...
Source: ChEMBL
Target: Hylobius abietis
External Id: CHEMBL3051815
|
| methyl cinnamate dibromide |
| 2,3-dibromo-3-phenyl-propionic acid methyl ester |
| opt.-inakt. 2,3-Dibrom-3-phenyl-propionsaeure-methylester |
| 2,3-dibromo-3-phenyl methyl propanoate |
| 2,3-Dibrom-3-phenyl-propionsaeure-methylester |