methyl 3,3-bis(tributylstannyl)propanoate structure
|
Common Name | methyl 3,3-bis(tributylstannyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 21785-86-4 | Molecular Weight | 666.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H60O2Sn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3,3-bis(tributylstannyl)propanoate |
|---|
| Molecular Formula | C28H60O2Sn2 |
|---|---|
| Molecular Weight | 666.17700 |
| Exact Mass | 668.26400 |
| PSA | 26.30000 |
| LogP | 9.22260 |
| InChIKey | JIIVKFLUMCVDGH-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(CC(=O)OC)[Sn](CCCC)(CCCC)CCCC |
|
~94%
methyl 3,3-bis(... CAS#:21785-86-4 |
| Literature: Meurice, Jean-Charles; Vallier, Martine; Ratier, Max; Duboudin, Jean-Georges; Petraud, Michel Journal of Organometallic Chemistry, 1997 , vol. 542, # 1 p. 67 - 73 |
|
~90%
methyl 3,3-bis(... CAS#:21785-86-4 |
| Literature: Isono, Naohiro; Mori, Miwako Journal of Organic Chemistry, 1998 , vol. 63, # 6 p. 1773 - 1779 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |