Bexarotene D4 structure
|
Common Name | Bexarotene D4 | ||
|---|---|---|---|---|
| CAS Number | 2182068-00-2 | Molecular Weight | 352.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H24D4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bexarotene D4Bexarotene D4 is a deuterium labeled Bexarotene (LGD1069). Bexarotene (LGD1069) is a selective retinoid X receptors (RXR) agonist for the treatment of cutaneous T-cell lymphoma[1][2][3][4][5]. |
| Name | Bexarotene D4 |
|---|
| Description | Bexarotene D4 is a deuterium labeled Bexarotene (LGD1069). Bexarotene (LGD1069) is a selective retinoid X receptors (RXR) agonist for the treatment of cutaneous T-cell lymphoma[1][2][3][4][5]. |
|---|---|
| Related Catalog | |
| References |
[5]. Cras A, Politis B, Balitrand N, Darsin-Bettinger D, Boelle PY, Cassinat B, Toubert ME, Chomienne C. |
| Molecular Formula | C24H24D4O2 |
|---|---|
| Molecular Weight | 352.50 |
| InChIKey | NAVMQTYZDKMPEU-ULDPCNCHSA-N |
| SMILES | C=C(c1ccc(C(=O)O)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |