1-benzoyl-5-methoxy-1H-indole structure
|
Common Name | 1-benzoyl-5-methoxy-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 21859-82-5 | Molecular Weight | 251.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-methoxyindol-1-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO2 |
|---|---|
| Molecular Weight | 251.28000 |
| Exact Mass | 251.09500 |
| PSA | 31.23000 |
| LogP | 3.33840 |
| InChIKey | GQERXICLDNNQLW-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(ccn2C(=O)c2ccccc2)c1 |
|
~75%
1-benzoyl-5-met... CAS#:21859-82-5 |
| Literature: Liou, Jing-Ping; Chang, Yi-Ling; Kuo, Fu-Ming; Chang, Chun-Wei; Tseng, Huan-Yi; Wang, Chiung-Chiu; Yang, Yung-Ning; Chang, Jang-Yang; Lee, Shiow-Ju; Hsieh, Hsing-Pang Journal of Medicinal Chemistry, 2004 , vol. 47, # 17 p. 4247 - 4257 |
|
~86%
1-benzoyl-5-met... CAS#:21859-82-5 |
| Literature: Katritzky, Alan R.; Khelashvili, Levan; Mohapatra, Prabhu P.; Steel, Peter J. Synthesis, 2007 , # 23 p. 3673 - 3677 |
|
~14%
1-benzoyl-5-met... CAS#:21859-82-5 |
| Literature: Bremner, John B.; Samosorn, Siritron; Ambrus, Joseph I. Synthesis, 2004 , # 16 p. 2653 - 2658 |
|
Name: Concentration required for the 50% inhibition of human uterine cancer (MESSA) cell li...
Source: ChEMBL
Target: MES-SA
External Id: CHEMBL833420
|
|
Name: Concentration required for the 50% inhibition of human lung caner (A549) cell line gr...
Source: ChEMBL
Target: A549
External Id: CHEMBL833809
|
|
Name: Concentration required for the 50% inhibition of human breast cancer (MCF-7) cell lin...
Source: ChEMBL
Target: MCF7
External Id: CHEMBL833398
|
|
Name: Concentration required for the 50% inhibition of human stomach cancer (NUGC3) cell li...
Source: ChEMBL
Target: NUGC-3
External Id: CHEMBL833419
|
|
Name: Concentration required for the 50% inhibition of human stomach cancer (MKN45) cell li...
Source: ChEMBL
Target: MKN-45
External Id: CHEMBL833418
|
| 1-benzoyl-5-methoxy-indole |
| 1-Benzoyl-5-methoxyindol |
| 1H-Indole,1-benzoyl-5-methoxy |
| N-Benzoyl-5-methoxy-indol |
| 1-benzoyl-5-methoxy-1H-indole |