2-(tert-Butyl)-4-(piperazin-1-yl)-6-(trifluoromethyl)pyrimidine structure
|
Common Name | 2-(tert-Butyl)-4-(piperazin-1-yl)-6-(trifluoromethyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 219599-99-2 | Molecular Weight | 288.312 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 363.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H19F3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.5±27.9 °C | |
| Name | 2-tert-butyl-4-piperazin-1-yl-6-(trifluoromethyl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.3±42.0 °C at 760 mmHg |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.312 |
| Flash Point | 173.5±27.9 °C |
| Exact Mass | 288.156189 |
| PSA | 41.05000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | LNKWEXSUCTYYAC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1nc(N2CCNCC2)cc(C(F)(F)F)n1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
2-(tert-Butyl)-... CAS#:219599-99-2 |
| Literature: Abbott Laboratories Patent: US6486162 B2, 2002 ; US 6486162 B2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrimidine, 2-(1,1-dimethylethyl)-4-(1-piperazinyl)-6-(trifluoromethyl)- |
| 2-tert-Butyl-4-(piperazin-1-yl)-6-trifluoromethyl-pyrimidine |
| 2-(2-Methyl-2-propanyl)-4-(1-piperazinyl)-6-(trifluoromethyl)pyrimidine |
| 2-t-butyl-4-piperazin-1-yl-6-trifluoromethylpyrimidine |