4',7-Dihydroxyflavone structure
|
Common Name | 4',7-Dihydroxyflavone | ||
|---|---|---|---|---|
| CAS Number | 2196-14-7 | Molecular Weight | 254.238 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 512.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H10O4 | Melting Point | 324-325ºC | |
| MSDS | N/A | Flash Point | 201.2±23.6 °C | |
Use of 4',7-Dihydroxyflavone7,4'-Dihydroxyflavone (7,4'-DHF) is a flavonoid isolated from Glycyrrhiza uralensis, the eotaxin/CCL11 inhibitor, has the ability to consistently suppress eotaxin production and prevent dexamethasone (Dex)‐paradoxical adverse effects on eotaxin production[1]. 7,4'-Dihydroxyflavone (7,4'-DHF) inhibits MUC5AC gene expression, mucus production and secretion via regulation of NF-κB, STAT6 and HDAC2.7,4'-Dihydroxyflavone (7,4'-DHF) decreases phorbol 12-myristate 13-acetate (PMA) stimulated NCI-H292 human airway epithelial cell MUC5AC gene expression and mucus production with IC50 value of 1.4 µM[1]. |
| Name | 4',7-dihydroxyflavone |
|---|---|
| Synonym | More Synonyms |
| Description | 7,4'-Dihydroxyflavone (7,4'-DHF) is a flavonoid isolated from Glycyrrhiza uralensis, the eotaxin/CCL11 inhibitor, has the ability to consistently suppress eotaxin production and prevent dexamethasone (Dex)‐paradoxical adverse effects on eotaxin production[1]. 7,4'-Dihydroxyflavone (7,4'-DHF) inhibits MUC5AC gene expression, mucus production and secretion via regulation of NF-κB, STAT6 and HDAC2.7,4'-Dihydroxyflavone (7,4'-DHF) decreases phorbol 12-myristate 13-acetate (PMA) stimulated NCI-H292 human airway epithelial cell MUC5AC gene expression and mucus production with IC50 value of 1.4 µM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 1.4 μM (NCI-H292 human airway epithelial cell) (7,4'-Dihydroxyflavone)[2] |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 512.8±50.0 °C at 760 mmHg |
| Melting Point | 324-325ºC |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.238 |
| Flash Point | 201.2±23.6 °C |
| Exact Mass | 254.057907 |
| PSA | 70.67000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | LCAWNFIFMLXZPQ-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(O)ccc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914501900 |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 7,4'-Dihydroxyflavanone |
| 4H-1-Benzopyran-4-one, 7-hydroxy-2-(4-hydroxyphenyl)- |
| 7,4'-Dihydroxyflavone |
| FLAVONE,4',7-DIHYDROXY |
| 7-Hydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| 7-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| 4',7-Dihydroxyflavone |