Pentanitroaniline structure
|
Common Name | Pentanitroaniline | ||
|---|---|---|---|---|
| CAS Number | 21985-87-5 | Molecular Weight | 318.11400 | |
| Density | 2.107g/cm3 | Boiling Point | 669.8ºC at 760 mmHg | |
| Molecular Formula | C6H2N6O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.9ºC | |
| Name | 2,3,4,5,6-pentanitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 2.107g/cm3 |
|---|---|
| Boiling Point | 669.8ºC at 760 mmHg |
| Molecular Formula | C6H2N6O10 |
| Molecular Weight | 318.11400 |
| Flash Point | 358.9ºC |
| Exact Mass | 317.98300 |
| PSA | 255.12000 |
| LogP | 4.00700 |
| Vapour Pressure | 8.34E-18mmHg at 25°C |
| Index of Refraction | 1.778 |
| InChIKey | XJYDCCKHUXCATF-UHFFFAOYSA-N |
| SMILES | Nc1c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| HS Code | 2921420090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Pentanitroaniline |
| 2,3,4,5,6-pentanitro-aniline |
| aminopentanitrobenzene |
| 2,3,4,5,6-Pentanitrobenzenamine |
| 2,3,4,5,6-Pentanitro-anilin |