3,5-Dinitroaniline structure
|
Common Name | 3,5-Dinitroaniline | ||
|---|---|---|---|---|
| CAS Number | 618-87-1 | Molecular Weight | 183.12200 | |
| Density | 1.586 g/cm3 | Boiling Point | 397.9ºC at 760 mmHg | |
| Molecular Formula | C6H5N3O4 | Melting Point | 160-162 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 194.4ºC | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
| Name | 3,5-Dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.586 g/cm3 |
|---|---|
| Boiling Point | 397.9ºC at 760 mmHg |
| Melting Point | 160-162 °C(lit.) |
| Molecular Formula | C6H5N3O4 |
| Molecular Weight | 183.12200 |
| Flash Point | 194.4ºC |
| Exact Mass | 183.02800 |
| PSA | 117.66000 |
| LogP | 2.71280 |
| Index of Refraction | 1.679 |
| InChIKey | MPBZUKLDHPOCLS-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H331-H373 |
| Precautionary Statements | P261-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R23/24/25;R33 |
| Safety Phrases | S28-S37-S45 |
| RIDADR | UN 1596 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | BX9200100 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2921420090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Mesomeric Effects of Graphene Modified with Diazonium Salts: Substituent Type and Position Influence its Properties.
Chemistry 21 , 17728-38, (2015) In the last decade, graphene and graphene derivatives have become some of the most intensively studied materials. Tuning of the electronic and electrochemical properties of graphene is of paramount im... |
| 3,5-dinitroaniline |
| EINECS 210-567-8 |
| MFCD00007263 |