[benzoyl(phenylmethoxy)amino] 4-formylbenzoate structure
|
Common Name | [benzoyl(phenylmethoxy)amino] 4-formylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 220168-47-8 | Molecular Weight | 375.37400 | |
| Density | 1.297g/cm3 | Boiling Point | 537.3ºC at 760mmHg | |
| Molecular Formula | C22H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.7ºC | |
| Name | [benzoyl(phenylmethoxy)amino] 4-formylbenzoate |
|---|
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 537.3ºC at 760mmHg |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.37400 |
| Flash Point | 278.7ºC |
| Exact Mass | 375.11100 |
| PSA | 72.91000 |
| LogP | 3.84510 |
| Vapour Pressure | 1.29E-11mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | CCGVDRYQMDQFJK-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(C(=O)ON(OCc2ccccc2)C(=O)c2ccccc2)cc1 |
|
~%
[benzoyl(phenyl... CAS#:220168-47-8 |
| Literature: Glover, Stephen A.; Hammond, Gerard P.; Bonin, Antonio M. Journal of Organic Chemistry, 1998 , vol. 63, # 26 p. 9684 - 9689 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |