tert-Butyl 3-(bromomethyl)benzylcarbamate structure
|
Common Name | tert-Butyl 3-(bromomethyl)benzylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 220364-34-1 | Molecular Weight | 300.191 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 390.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C13H18BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.2±24.6 °C | |
| Name | tert-butyl N-[[3-(bromomethyl)phenyl]methyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.9±30.0 °C at 760 mmHg |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.191 |
| Flash Point | 190.2±24.6 °C |
| Exact Mass | 299.052094 |
| PSA | 41.82000 |
| LogP | 3.59 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | ZAWVAHJDHPLCQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(CBr)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~65%
tert-Butyl 3-(b... CAS#:220364-34-1 |
| Literature: Alantos Pharmaceuticals, Inc., Patent: US2006/173183 A1, 2006 ; Location in patent: Page/Page column 113 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid, N-[[3-(bromomethyl)phenyl]methyl]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl [3-(bromomethyl)benzyl]carbamate |