1,2,3,4-Tetrachloro-5,5-dimethoxycyclopentadiene structure
|
Common Name | 1,2,3,4-Tetrachloro-5,5-dimethoxycyclopentadiene | ||
|---|---|---|---|---|
| CAS Number | 2207-27-4 | Molecular Weight | 263.93300 | |
| Density | 1.501 | Boiling Point | 108-110ºC (11 MMHG) | |
| Molecular Formula | C7H6Cl4O2 | Melting Point | 26-28ºC | |
| MSDS | Chinese USA | Flash Point | 67ºC | |
| Name | 1,2,3,4-tetrachloro-5,5-dimethoxycyclopenta-1,3-diene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.501 |
|---|---|
| Boiling Point | 108-110ºC (11 MMHG) |
| Melting Point | 26-28ºC |
| Molecular Formula | C7H6Cl4O2 |
| Molecular Weight | 263.93300 |
| Flash Point | 67ºC |
| Exact Mass | 261.91200 |
| PSA | 18.46000 |
| LogP | 3.36750 |
| Vapour Pressure | 0.0614mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | UHSMEJQTFMHABA-UHFFFAOYSA-N |
| SMILES | COC1(OC)C(Cl)=C(Cl)C(Cl)=C1Cl |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| HS Code | 2903890090 |
|
~87%
1,2,3,4-Tetrach... CAS#:2207-27-4 |
| Literature: Malihi, Farzad; Clive, Derrick L. J.; Chang, Che-Chien; Minaruzzaman Journal of Organic Chemistry, 2013 , vol. 78, # 3 p. 996 - 1013 |
|
~%
1,2,3,4-Tetrach... CAS#:2207-27-4 |
| Literature: Journal of the American Chemical Society, , vol. 71, p. 946,950 |
|
~%
1,2,3,4-Tetrach... CAS#:2207-27-4 |
| Literature: Tetrahedron, , vol. 25, p. 1265 - 1280 Journal of Organic Chemistry, , vol. 30, p. 2635 - 2639 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Polycyclitols: synthesis of novel carbasugar and conduritol analogues as potential glycosidase inhibitors.
Tetrahedron Lett. 42(10) , 1987-1990, (2001)
|
| 2,3,4,5-tetrachloro-1,1-dimethoxycyclopenta-2,4-diene |
| 5,5-dimethoxy-1,2,3,4-tetrachlorocyclopenta-1,3-diene |
| 1,3-Cyclopentadiene,1,2,3,4-tetrachloro-5,5-dimethoxy |
| EINECS 218-623-3 |
| 5,5-Dimethoxy-1,2,3,4-tetrachlorocyclopentadiene |
| 2,3,4,5-tetrachlorocyclopentadienone dimethyl acetal |
| 1,1-dimethoxy-2,3,4,5-tetrachlorocyclopentadiene |
| 1,2,3,4-Tetrachloro-5,5-dimethoxycyclopentadiene |
| MFCD00001353 |