Lumiracoxib structure
|
Common Name | Lumiracoxib | ||
|---|---|---|---|---|
| CAS Number | 220991-20-8 | Molecular Weight | 293.721 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 395.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H13ClFNO2 | Melting Point | 139-141ºC | |
| MSDS | N/A | Flash Point | 193.1±27.9 °C | |
Use of LumiracoxibLumiracoxib, also known as CGS 35189 and COX 189, is a COX-2 selective inhibitor non-steroidal anti-inflammatory drug, manufactured by Novartis and still sold in few countries, including Mexico, Ecuador and the Dominican Republic, under the trade name Prexige. Since its original approval, lumiracoxib has been withdrawn from the market in several countries, mostly due to its potential for causing liver failure (sometimes requiring liver transplantation). It has never been approved for use in the United States. |
| Name | lumiracoxib |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.7±42.0 °C at 760 mmHg |
| Melting Point | 139-141ºC |
| Molecular Formula | C15H13ClFNO2 |
| Molecular Weight | 293.721 |
| Flash Point | 193.1±27.9 °C |
| Exact Mass | 293.061890 |
| PSA | 49.33000 |
| LogP | 3.90 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | KHPKQFYUPIUARC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2c(F)cccc2Cl)c(CC(=O)O)c1 |
| Storage condition | -20°C Freezer |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| 2-[(2-chloro-6-fluorophenyl)amino]-5-methyl-benzeneacetic acid |
| Prexige (Novartis) |
| 2-(2-((2-chloro-6-fluorophenyl)amino)-5-methylphenyl)acetic acid |
| {2-[(2-Chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid |
| Prexige |
| COX189 |
| 5-methyl-2-(2'-chloro-6'-fluoroanilino)phenylacetic acid |
| Joicela |
| Benzeneacetic acid, 2-[(2-chloro-6-fluorophenyl)amino]-5-methyl- |
| (2-((2-chloro-6-fluorophenyl)-amino)-5-methylphenyl)-acetic acid |
| Lumiracoxib |
| [14C]-Lumiracoxib |
| 2-[2-(2-chloro-6-fluoroanilino)-5-methylphenyl]acetic acid |
| Lumiracoxib [USAN:INN] |