5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrin structure
|
Common Name | 5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrin | ||
|---|---|---|---|---|
| CAS Number | 22112-78-3 | Molecular Weight | 734.840 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C48H38N4O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of 5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrin |
| Name | 5,10,15,20-tetrakis(4-methoxyphenyl)-21,22-dihydroporphyrin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C48H38N4O4 |
| Molecular Weight | 734.840 |
| Exact Mass | 734.289307 |
| PSA | 93.22000 |
| LogP | 11.62 |
| Index of Refraction | 1.657 |
| InChIKey | PJOJZHHAECOAFH-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(OC)cc4)c4ccc([nH]4)c(-c4ccc(OC)cc4)c4nc(c(-c5ccc(OC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
|
Synthesis, spectroscopic properties and photodynamic activity of porphyrin-fullerene C60 dyads with application in the photodynamic inactivation of Staphylococcus aureus.
Eur. J. Med. Chem. 83 , 685-94, (2014) A covalently linked porphyrin-fullerene C60 dyad 5 was synthesized by 1,3-dipolar cycloaddition using 5-(4-formylphenyl)-10,15,20-tris[3-(N-ethylcarbazoyl)]porphyrin, N-methylglycine and fullerene C60... |
|
|
Chirality amplification of porphyrin assemblies exclusively constructed from achiral porphyrin derivatives. Chen P, et al.
ChemPhysChem 7(11) , 2419-2423, (2006)
|
| 4-Methoxy-1-[7,12,17-tris(4-methoxyphenyl)-21,22,23,24-tetraazapentacyclo[16.2.1.1<3,6>.1<8,11>.1<13,16>]tetracosa-1(21),2,4,6,8(23),9,11,13,15,17,19-undecaen-2-yl]benzene |
| tetraanisylporphin |
| meso-tetrakis-(4-methoxyphenyl)porphyrin |
| MFCD00012072 |
| 5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrin |
| 4-methoxy-1-[7,12,17-tris(4-methoxyphenyl)-21,22,23,24-tetraazapentacyclo[16.2 .1.1 |
| 21H,23H-Porphine, 5,10,15,20-tetrakis(4-methoxyphenyl)- |
| Tetrakis(4-methoxyphenyl)porphine |
| 21H,23H-Porphine,5,10,15,20-tetrakis(4-methoxyphenyl) |
| Porphine, 5,10,15,20-tetrakis(p-methoxyphenyl)- |
| 5,10,15,20-Tetrakis(4-methoxyphenyl)-21H,23H-porphine |