5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin structure
|
Common Name | 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin | ||
|---|---|---|---|---|
| CAS Number | 22843-73-8 | Molecular Weight | 794.726 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H26N8O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,10,15,20-tetrakis(4-nitrophenyl)-21,22-dihydroporphyrin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C44H26N8O8 |
| Molecular Weight | 794.726 |
| Exact Mass | 794.187378 |
| PSA | 239.58000 |
| LogP | 10.83 |
| Index of Refraction | 1.732 |
| InChIKey | FVHZCBQLLFLQAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)[N+](=O)[O-])C8=CC=C(C=C8)[N+](=O)[O-])C=C4)C9=CC=C(C=C9)[N+](=O)[O-])N3)[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin |
| Tetra(p-nitrophenyl)porphyrin |
| 21H,23H-Porphine, 5,10,15,20-tetrakis(4-nitrophenyl)- |