Erysubin A structure
|
Common Name | Erysubin A | ||
|---|---|---|---|---|
| CAS Number | 221150-18-1 | Molecular Weight | 352.34 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 493.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.3±28.7 °C | |
Use of Erysubin AErysubin A is a prenylated isoflavonoid that can be isolated from Erinacea anthyllis[1]. |
| Name | 4-Hydroxy-6-(4-hydroxyphenyl)-2-(2-hydroxy-2-propanyl)-5H-furo[3, 2-g]chromen-5-one |
|---|---|
| Synonym | More Synonyms |
| Description | Erysubin A is a prenylated isoflavonoid that can be isolated from Erinacea anthyllis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 493.6±45.0 °C at 760 mmHg |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 |
| Flash Point | 252.3±28.7 °C |
| Exact Mass | 352.094696 |
| PSA | 104.04000 |
| LogP | 3.47 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.703 |
| InChIKey | FJWVISOPPWPZGU-UHFFFAOYSA-N |
| SMILES | CC(C)(O)c1cc2c(O)c3c(=O)c(-c4ccc(O)cc4)coc3cc2o1 |
| Hazard Codes | Xi |
|---|
| 4-Hydroxy-6-(4-hydroxyphenyl)-2-(2-hydroxy-2-propanyl)-5H-furo[3,2-g]chromen-5-one |
| 5H-Furo[3,2-g][1]benzopyran-5-one, 4-hydroxy-2-(1-hydroxy-1-methylethyl)-6-(4-hydroxyphenyl)- |