Tribuloside structure
|
Common Name | Tribuloside | ||
|---|---|---|---|---|
| CAS Number | 22153-44-2 | Molecular Weight | 594.52000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H26O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TribulosideTribuloside, is isolated fromPotentilla multifid. Tribuloside exhibits anti-mycobacterial activity against the non-pathogenic Mycobacterium species with a minimum inhibitory concentration (MIC) 5.0 mg/mL. Tribuloside has 1,1-diphenyl-2-picrylhydrazyl radical scavenging activity[1]. Tribuloside possesses antidepressant effect, improves behavior and BrdU immunoreactive cells of depression model rats[2]. |
| Name | [(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Tribuloside, is isolated fromPotentilla multifid. Tribuloside exhibits anti-mycobacterial activity against the non-pathogenic Mycobacterium species with a minimum inhibitory concentration (MIC) 5.0 mg/mL. Tribuloside has 1,1-diphenyl-2-picrylhydrazyl radical scavenging activity[1]. Tribuloside possesses antidepressant effect, improves behavior and BrdU immunoreactive cells of depression model rats[2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C30H26O13 |
|---|---|
| Molecular Weight | 594.52000 |
| Exact Mass | 594.13700 |
| PSA | 216.58000 |
| LogP | 1.72540 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | DVGGLGXQSFURLP-PYFXTMFGSA-N |
| SMILES | O=C(C=Cc1ccc(O)cc1)OCC1OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)C1O |
| Tribuloside |
| Tribuloside A |