fenamiphos structure
|
Common Name | fenamiphos | ||
|---|---|---|---|---|
| CAS Number | 22224-92-6 | Molecular Weight | 303.357 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 375.6±52.0 °C at 760 mmHg | |
| Molecular Formula | C13H22NO3PS | Melting Point | 49°C | |
| MSDS | Chinese USA | Flash Point | 181.0±30.7 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | fenamiphos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.6±52.0 °C at 760 mmHg |
| Melting Point | 49°C |
| Molecular Formula | C13H22NO3PS |
| Molecular Weight | 303.357 |
| Flash Point | 181.0±30.7 °C |
| Exact Mass | 303.105804 |
| PSA | 82.67000 |
| LogP | 3.68 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | ZCJPOPBZHLUFHF-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(NC(C)C)Oc1ccc(SC)c(C)c1 |
| Water Solubility | 0.07 g/100 mL |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H310 + H330-H319-H410 |
| Precautionary Statements | P260-P280-P301 + P310 + P330-P302 + P352 + P310-P304 + P340 + P310-P403 + P233 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+:Verytoxic;N:Dangerous for the environment; |
| Risk Phrases | R24;R28;R50/53 |
| Safety Phrases | S23-S28-S36/37-S45-S60-S61 |
| RIDADR | UN 2811/3017 |
| RTECS | TB3675000 |
| Packaging Group | I |
| Hazard Class | 6.1(a) |
| HS Code | 2930909064 |
|
~%
fenamiphos CAS#:22224-92-6 |
| Literature: Tetrahedron, , vol. 51, # 29 p. 7981 - 7992 |
| HS Code | 2930909064 |
|---|---|
| Summary | 2930909064 s-((n-(2-chlorophenyl)butyramido)methyl) o,o-dimethyl phosphorodithioate |
|
Factors affecting the efficacy of non-fumigant nematicides for controlling root-knot nematodes.
Pest Manag. Sci. 61(10) , 961-72, (2005) Second-stage juveniles (J2) and egg masses of root-knot nematodes as well as root debris heavily infected by the latter were exposed for different periods of time to six different doses of the nematic... |
|
|
Enhanced microbial degradation of cadusafos in soils from potato monoculture: demonstration and characterization.
Chemosphere 56(6) , 549-59, (2004) Rapid degradation of cadusafos was evident in soils collected from previously-treated field sites from a potato monoculture area in northern Greece. The slower degradation of cadusafos observed in cor... |
|
|
Detections of eleven organophosphorus insecticides and one herbicide threatening Pacific salmonids, Oncorhynchus spp., in California, 1991-2010.
Bull. Environ. Contam. Toxicol. 87(4) , 355-60, (2011) California's surface water monitoring results from 1991 through 2010 were analyzed to determine whether 12 organophosphorus insecticides and herbicides (i.e., azinphos methyl, bensulide, dimethoate, d... |
| Fenamiphos PESTANAL(R),analytical standard |
| Caswell No. 453A |
| Nemacur P |
| Ethyl 3-methyl-4-(methylsulfanyl)phenyl isopropylphosphoramidate |
| (RS)-(ethyl 4-methylthio-m-tolyl isopropylphosphoramidate) |
| N-[ethoxy-(3-methyl-4-methylsulfanylphenoxy)phosphoryl]propan-2-amine |
| 1Y1&MPO&O2&OR C1 DS1 |
| (Ξ)-[ethyl 3-methyl-4-(methylsulfanyl)phenyl propan-2-ylphosphoramidate] |
| MFCD00055454 |
| Phosphoramidic acid, N-(1-methylethyl)-, ethyl 3-methyl-4-(methylthio)phenyl ester |
| fenamiphos |
| Nemacur |
| ethyl 3-methyl-4-(methylthio)phenyl (1-methylethyl)phosphoramidate |
| Methaphenamiphos |
| Ethyl 3-methyl-4-(methylsulfanyl)phenyl propan-2-ylphosphoramidate |
| Phenamiphos |
| EINECS 244-848-1 |