3-Nitro-2-bornanone structure
|
Common Name | 3-Nitro-2-bornanone | ||
|---|---|---|---|---|
| CAS Number | 2243-88-1 | Molecular Weight | 197.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,7,7-trimethyl-2-nitrobicyclo[2.2.1]heptan-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15NO3 |
|---|---|
| Molecular Weight | 197.23100 |
| Exact Mass | 197.10500 |
| PSA | 62.89000 |
| LogP | 2.18010 |
| InChIKey | SYWPFFHYANKVSU-UHFFFAOYSA-N |
| SMILES | CC12CCC(C([N+](=O)[O-])C1=O)C2(C)C |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-Nitro-campher |
| 3-Nitro-bornan-2-on |
| 3-nitro-bornan-2-one |
| 2-Bornanone,3-nitro-,d |
| 3-nitrocamphor |