2-Nitro-4-(trifluoromethyl)benzyl chloride structure
|
Common Name | 2-Nitro-4-(trifluoromethyl)benzyl chloride | ||
|---|---|---|---|---|
| CAS Number | 225656-59-7 | Molecular Weight | 239.57900 | |
| Density | 1.474g/cm3 | Boiling Point | 252.5ºC at 760mmHg | |
| Molecular Formula | C8H5ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.5ºC | |
| Name | 2-Nitro-4-(trifluoromethyl)benzyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.474g/cm3 |
|---|---|
| Boiling Point | 252.5ºC at 760mmHg |
| Molecular Formula | C8H5ClF3NO2 |
| Molecular Weight | 239.57900 |
| Flash Point | 106.5ºC |
| Exact Mass | 238.99600 |
| PSA | 45.82000 |
| LogP | 3.87560 |
| Vapour Pressure | 0.0306mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | JWFRBTUSUAFGOS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1CCl |
| Hazard Codes | C: Corrosive;Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(chloromethyl)-2-nitro-4-(trifluoromethyl)benzene |
| MFCD01631694 |