3-bromo-1-(4-methylbenzenesulfonyl)-1H-pyrrolo[2,3-b]pyridine structure
|
Common Name | 3-bromo-1-(4-methylbenzenesulfonyl)-1H-pyrrolo[2,3-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 226085-18-3 | Molecular Weight | 351.21800 | |
| Density | 1.597g/cm3 | Boiling Point | 514.893ºC at 760 mmHg | |
| Molecular Formula | C14H11BrN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.198ºC | |
| Name | 3-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.597g/cm3 |
|---|---|
| Boiling Point | 514.893ºC at 760 mmHg |
| Molecular Formula | C14H11BrN2O2S |
| Molecular Weight | 351.21800 |
| Flash Point | 265.198ºC |
| Exact Mass | 349.97200 |
| PSA | 60.34000 |
| LogP | 4.42500 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | NDJOLIOBEZICFO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(Br)c3cccnc32)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~91%
3-bromo-1-(4-me... CAS#:226085-18-3 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED; TAYLOR, Lori, Kell; SEWELL, Kathryn, Lea; HOOCK, Thomas, Carl Patent: WO2014/74471 A1, 2014 ; Location in patent: Paragraph 0271-0274 ; |
|
~85%
3-bromo-1-(4-me... CAS#:226085-18-3 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED? Patent: WO2005/95400 A1, 2005 ; Location in patent: Page/Page column 326; 327 ; WO 2005/095400 A1 |
|
~%
3-bromo-1-(4-me... CAS#:226085-18-3 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED; TAYLOR, Lori, Kell; SEWELL, Kathryn, Lea; HOOCK, Thomas, Carl Patent: WO2014/74471 A1, 2014 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| QC-3822 |
| 3-bromo-1-tosyl-1H-pyrrolo[2,3-b]pyridine |
| 3-bromo-1-(toluene-4-sulfonyl)-1H-pyrrolo[2,3-b]pyridine |
| 1H-PYRROLO[2,3-B]PYRIDINE,3-BROMO-1-[(4-METHYLPHENYL)SULFONYL] |
| 3-bromo-1-(4-methylsulfonyl)-7-azaindole |