fosamprenavir structure
|
Common Name | fosamprenavir | ||
|---|---|---|---|---|
| CAS Number | 226700-79-4 | Molecular Weight | 585.61 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H36N3O9PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of fosamprenavirFosamprenavir (Amprenavir phosphate;GW 433908) is a phosphate ester prodrug of the antiretroviral protease inhibitor Amprenavir, with improved solubility[1]. Anti-HIV infection[1]. |
| Name | fosamprenavir |
|---|---|
| Synonym | More Synonyms |
| Description | Fosamprenavir (Amprenavir phosphate;GW 433908) is a phosphate ester prodrug of the antiretroviral protease inhibitor Amprenavir, with improved solubility[1]. Anti-HIV infection[1]. |
|---|---|
| Related Catalog | |
| Target |
HIV[1] |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C25H36N3O9PS |
| Molecular Weight | 585.61 |
| Exact Mass | 585.190979 |
| PSA | 195.91000 |
| LogP | 3.36 |
| Index of Refraction | 1.612 |
| InChIKey | MLBVMOWEQCZNCC-OEMFJLHTSA-N |
| SMILES | CC(C)CN(CC(OP(=O)(O)O)C(Cc1ccccc1)NC(=O)OC1CCOC1)S(=O)(=O)c1ccc(N)cc1 |
| Storage condition | 2-8℃ |
| fosamprenavir |
| (3S)-Tetrahydro-3-furanyl [(2S,3R)-4-{[(4-aminophenyl)sulfonyl](isobutyl)amino}-1-phenyl-3-(phosphonooxy)-2-butanyl]carbamate |
| Lexiva |
| Amprenavir phosphate |
| ((1S,2R)-3-(((4-Aminophenyl)sulfonyl)(2-methylpropyl)amino)-1-(phenylmethyl)-2-(phosphonooxy)propyl)carbamic Acid C-((3S)-Tetrahydro-3-furanyl) Ester |
| ((3S)Oxolan-3-yloxy)-N-((1S,2R)-3-{[(4-aminophenyl)sulfonyl](2-methylpropyl)amino}-1-benzyl-2-(phosphonooxy)propyl)carboxamide |
| (3S)-Tetrahydrofuran-3-yl [(2S,3R)-4-{[(4-aminophenyl)sulfonyl](isobutyl)amino}-1-phenyl-3-(phosphonooxy)butan-2-yl]carbamate |
| GW 433 908 |
| Carbamic acid, N-[(1S,2R)-3-[[(4-aminophenyl)sulfonyl](2-methylpropyl)amino]-1-(phenylmethyl)-2-(phosphonooxy)propyl]-, (3S)-tetrahydro-3-furanyl ester |