Pomalidomide-PEG4-azide
Modify Date: 2025-08-26 16:43:48
Pomalidomide-PEG4-azide structure
|
Common Name | Pomalidomide-PEG4-azide | ||
|---|---|---|---|---|
| CAS Number | 2271036-47-4 | Molecular Weight | 518.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30N6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pomalidomide-PEG4-azidePomalidomide-PEG4-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Pomalidomide-PEG4-azide |
|---|
| Description | Pomalidomide-PEG4-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C23H30N6O8 |
|---|---|
| Molecular Weight | 518.52 |
| InChIKey | SMHKJRVPSDESLS-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |