4-chlorobenzil structure
|
Common Name | 4-chlorobenzil | ||
|---|---|---|---|---|
| CAS Number | 22711-23-5 | Molecular Weight | 244.67300 | |
| Density | 1.272g/cm3 | Boiling Point | 388.2ºC at 760 mmHg | |
| Molecular Formula | C14H9ClO2 | Melting Point | 66-67°C | |
| MSDS | N/A | Flash Point | 164.1ºC | |
| Name | 1-(4-chlorophenyl)-2-phenylethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 388.2ºC at 760 mmHg |
| Melting Point | 66-67°C |
| Molecular Formula | C14H9ClO2 |
| Molecular Weight | 244.67300 |
| Flash Point | 164.1ºC |
| Exact Mass | 244.02900 |
| PSA | 34.14000 |
| LogP | 3.40560 |
| Vapour Pressure | 3.12E-06mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | QDCKVAZDINMMHO-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1ccc(Cl)cc1)c1ccccc1 |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R21/22:Harmful in contact with skin and if swallowed . R34:Causes burns. |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 1 |
| RTECS | EK7897000 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2914700090 |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Chlorodibenzoyl |
| MFCD00013646 |
| EINECS 245-169-3 |
| 4-Chlorobenzil |