4-Chlorobenzoin structure
|
Common Name | 4-Chlorobenzoin | ||
|---|---|---|---|---|
| CAS Number | 39774-18-0 | Molecular Weight | 246.68900 | |
| Density | 1.286g/cm3 | Boiling Point | 407.098ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO2 | Melting Point | 89-93ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 200.006ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4-chlorophenyl)-2-hydroxy-2-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 407.098ºC at 760 mmHg |
| Melting Point | 89-93ºC(lit.) |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.68900 |
| Flash Point | 200.006ºC |
| Exact Mass | 246.04500 |
| PSA | 37.30000 |
| LogP | 3.25630 |
| Index of Refraction | 1.618 |
| InChIKey | XYUKKJIDPMMCMJ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)C(O)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 36/37 |
| RIDADR | NONH for all modes of transport |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| 4-Chlor-benzoin |
| p-Chlorbenzoin |
| 4'-chlorobenzoin |
| p-chlorobenzoin |