isostearic acid structure
|
Common Name | isostearic acid | ||
|---|---|---|---|---|
| CAS Number | 22890-21-7 | Molecular Weight | 284.47700 | |
| Density | 0.88 g/cm3 | Boiling Point | 183ºC 5mm | |
| Molecular Formula | C18H36O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | 2-heptylundecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.88 g/cm3 |
|---|---|
| Boiling Point | 183ºC 5mm |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.47700 |
| Flash Point | 165ºC |
| Exact Mass | 284.27200 |
| PSA | 37.30000 |
| LogP | 6.18840 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | YLZIMEJTDZWVJG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(CCCCCCC)C(=O)O |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2915701000 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2-heptyl-undecanoic acid |
| UNII-E2U1CDE0CQ |
| HA 18Ga |
| I0281 |
| 2-Heptylundecanoic Acid |
| Diadol 18Ga |
| 2-Heptylundecansaeure |
| Heptadecane-8-carboxylic Acid |
| Undecanoic acid,2-heptyl |