MAPK13-IN-1 structure
|
Common Name | MAPK13-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 229002-10-2 | Molecular Weight | 365.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MAPK13-IN-1MPAK13-IN-1 is a MAPK13 (p38δ) inhibitor, with an IC50 of 620 nM. |
| Name | MAPK13-IN-1 |
|---|
| Description | MPAK13-IN-1 is a MAPK13 (p38δ) inhibitor, with an IC50 of 620 nM. |
|---|---|
| Related Catalog | |
| Target |
MAPK13 (p38δ):620 nM (IC50) |
| References |
| Molecular Formula | C20H23N5O2 |
|---|---|
| Molecular Weight | 365.43 |
| InChIKey | MHSLDASSAFCCDO-UHFFFAOYSA-N |
| SMILES | Cn1nc(C(C)(C)C)cc1NC(=O)Nc1ccc(Oc2ccncc2)cc1 |