Desmethoxycentaureidin structure
|
Common Name | Desmethoxycentaureidin | ||
|---|---|---|---|---|
| CAS Number | 22934-99-2 | Molecular Weight | 330.29 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 621.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.8±25.0 °C | |
Use of DesmethoxycentaureidinDemethoxycentaureidin (NSC 689466) is a natural product that can be isolated from Peucephyllum schottii[1]. |
| Name | 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-chromen- 4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Demethoxycentaureidin (NSC 689466) is a natural product that can be isolated from Peucephyllum schottii[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 621.2±55.0 °C at 760 mmHg |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 |
| Flash Point | 232.8±25.0 °C |
| Exact Mass | 330.073944 |
| PSA | 109.36000 |
| LogP | 2.59 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | VCWFILUULGOFCD-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)cc1O |
| Hazard Codes | Xi |
|---|
|
~%
Desmethoxycenta... CAS#:22934-99-2 |
| Literature: Dong a Pharmaceutical Co., Ltd. Patent: US6025387 A1, 2000 ; |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Desmethoxycentaureidin |
| 5,7,3'-trihydroxy-6,4'-dimethoxyflavone |
| 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxy- |
| 3',5,7-trihydroxy-4',6-dimethoxy flavone |
| 5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-chromen-4-one |
| 6-hydroxyluteolin-6,4'-dimethyl ether |
| 6-Hydroxy-lin.-trans-chinacridon |