2-Propen-1-one,3-(3-chlorophenyl)-1-phenyl-, (2E)- structure
|
Common Name | 2-Propen-1-one,3-(3-chlorophenyl)-1-phenyl-, (2E)- | ||
|---|---|---|---|---|
| CAS Number | 22966-13-8 | Molecular Weight | 242.70000 | |
| Density | 1.202g/cm3 | Boiling Point | 382.6ºC at 760 mmHg | |
| Molecular Formula | C15H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.5ºC | |
| Name | (E)-3-(3-chlorophenyl)-1-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760 mmHg |
| Molecular Formula | C15H11ClO |
| Molecular Weight | 242.70000 |
| Flash Point | 210.5ºC |
| Exact Mass | 242.05000 |
| PSA | 17.07000 |
| LogP | 4.23610 |
| Vapour Pressure | 4.68E-06mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | XBFMSIZYORSEPA-MDZDMXLPSA-N |
| SMILES | O=C(C=Cc1cccc(Cl)c1)c1ccccc1 |
|
~96%
2-Propen-1-one,... CAS#:22966-13-8 |
| Literature: Stroba, Adriana; Schaeffer, Francis; Hindie, Valerie; Lopez-Garcia, Laura; Adrian, Iris; Froehner, Wolfgang; Hartmann, Rolf W.; Biondi, Ricardo M.; Engel, Matthias Journal of Medicinal Chemistry, 2009 , vol. 52, # 15 p. 4683 - 4693 |
|
~%
2-Propen-1-one,... CAS#:22966-13-8 |
| Literature: Raghavan, R. S.; Velayutham, K.; Rajendran, V. Indian Journal of Chemistry, Section A: Inorganic, Physical, Theoretical & Analytical, 1984 , vol. 23, # 6 p. 466 - 469 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| 4-chlorobenzalacetophenone |
| 1-Phenyl-3-(m-chlor-phenyl)-pyrazol-4-aldehyd |
| 3-(3-Chloro-phenyl)-1-phenyl-1H-pyrazole-4-carbaldehyde |
| 3-(3-chlorophenyl)-1-phenylprop-2-enone |
| phenyl m-chlorostyryl ketone |
| 3-(3-chloro-phenyl)-1-phenyl-propenone |
| 3-(3-chlorophenyl)-1-phenylprop-2-en-1-one |
| 3-chlorochalcone |