1-(4-nitrophenoxy)-3-(trifluoromethyl)benzene structure
|
Common Name | 1-(4-nitrophenoxy)-3-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 2303-26-6 | Molecular Weight | 283.20300 | |
| Density | 1.378g/cm3 | Boiling Point | 324ºC at 760 mmHg | |
| Molecular Formula | C13H8F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.7ºC | |
| Name | 1-(4-nitrophenoxy)-3-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 324ºC at 760 mmHg |
| Molecular Formula | C13H8F3NO3 |
| Molecular Weight | 283.20300 |
| Flash Point | 149.7ºC |
| Exact Mass | 283.04600 |
| PSA | 55.05000 |
| LogP | 4.92910 |
| Vapour Pressure | 0.000478mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | TZKXAWZIUQTCFP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2cccc(C(F)(F)F)c2)cc1 |
| HS Code | 2909309090 |
|---|
|
~%
1-(4-nitropheno... CAS#:2303-26-6 |
| Literature: Takeda Chem. Ind. Patent: FR2254549DE2458375 , 19751975 ; Chem.Abstr., 1975 , vol. 83, # 192851 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3'-Trifluormethyl-4-nitro-diphenyl-ether |