Dimethyl 4-methylisophthalate structure
|
Common Name | Dimethyl 4-methylisophthalate | ||
|---|---|---|---|---|
| CAS Number | 23038-61-1 | Molecular Weight | 208.211 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 284.3±20.0 °C at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.8±20.2 °C | |
| Name | dimethyl 4-methylbenzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 284.3±20.0 °C at 760 mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Flash Point | 136.8±20.2 °C |
| Exact Mass | 208.073563 |
| PSA | 52.60000 |
| LogP | 2.91 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | MTDRWWFCMSDTBL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C)c(C(=O)OC)c1 |
| HS Code | 2917399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,3-Benzenedicarboxylic acid,4-methyl-,dimethyl ester |
| EINECS 245-393-1 |
| 4-Methyl-dimethyl isophthalate |
| 1,3-Benzenedicarboxylic acid, 4-methyl-, dimethyl ester |
| Dimethyl 4-methyl-1,3-benzenedicarboxylate |
| Dimethyl 4-methylisophthalate |
| 4-methyl-isophthalic acid dimethyl ester |
| 4-Methyl-isophthalsaeuredimethylester |