9H-Fluoren-2-amine,N-[(4-nitrophenyl)methylene]- structure
|
Common Name | 9H-Fluoren-2-amine,N-[(4-nitrophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 23072-71-1 | Molecular Weight | 314.33700 | |
| Density | 1.25g/cm3 | Boiling Point | 542.1ºC at 760mmHg | |
| Molecular Formula | C20H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.6ºC | |
| Name | 4-nitrophenyl-1-piperidinylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 542.1ºC at 760mmHg |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.33700 |
| Flash Point | 281.6ºC |
| Exact Mass | 314.10600 |
| PSA | 58.18000 |
| LogP | 5.43980 |
| Vapour Pressure | 2.89E-11mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | MXWZUMQQPOAIOP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=Nc2ccc3c(c2)Cc2ccccc2-3)cc1 |
| HS Code | 2925290090 |
|---|
|
~%
9H-Fluoren-2-am... CAS#:23072-71-1 |
| Literature: Krasovitskii,B.M.; Nazarenko,A.I. Journal of Organic Chemistry USSR (English Translation), 1967 , vol. 3, p. 150 - 156 Zhurnal Organicheskoi Khimii, 1967 , vol. 3, p. 155 - 162 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-nitrophenyl piperidyl ketone |
| N-p-nitrobenzoylpiperidine |