2-(3-Amino-2,4,6-triiodophenyl)valeric acid structure
|
Common Name | 2-(3-Amino-2,4,6-triiodophenyl)valeric acid | ||
|---|---|---|---|---|
| CAS Number | 23217-86-9 | Molecular Weight | 570.93200 | |
| Density | 2.422g/cm3 | Boiling Point | 532ºC at 760 mmHg | |
| Molecular Formula | C11H12I3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.5ºC | |
| Name | 2-(3-amino-2,4,6-triiodophenyl)pentanoic acid |
|---|
| Density | 2.422g/cm3 |
|---|---|
| Boiling Point | 532ºC at 760 mmHg |
| Molecular Formula | C11H12I3NO2 |
| Molecular Weight | 570.93200 |
| Flash Point | 275.5ºC |
| Exact Mass | 570.80000 |
| PSA | 63.32000 |
| LogP | 4.63210 |
| Vapour Pressure | 3.81E-12mmHg at 25°C |
| Index of Refraction | 1.731 |
| InChIKey | QTPSBMKJBKPOTM-UHFFFAOYSA-N |
| SMILES | CCCC(C(=O)O)c1c(I)cc(I)c(N)c1I |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |