2-Chloro-4-(trifluoromethyl)benzoic acid structure
|
Common Name | 2-Chloro-4-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 23228-45-7 | Molecular Weight | 224.564 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 255.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClF3O2 | Melting Point | 114-117℃ | |
| MSDS | N/A | Flash Point | 108.0±27.3 °C | |
| Name | 2-chloro-4-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 255.0±40.0 °C at 760 mmHg |
| Melting Point | 114-117℃ |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.564 |
| Flash Point | 108.0±27.3 °C |
| Exact Mass | 223.985199 |
| PSA | 37.30000 |
| LogP | 3.44 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | DTIJZEUKFYGSEC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(F)(F)F)cc1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
|
~68%
2-Chloro-4-(tri... CAS#:23228-45-7 |
| Literature: Tetrahedron Letters, , vol. 37, # 16 p. 2767 - 2770 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-chloro-4-trifluoromethyl-benzoic acid |
| 2-chloro-4-(trifluoromethyl)-benzoate |
| 4-Carboxy-3-chlorobenzotrifluoride |
| 2-Chloro-α,α,α-trifluoro-p-toluic acid |
| Benzoic acid, 2-chloro-4-(trifluoromethyl)- |
| 2-Chloro-4-(trifluoromethyl)benzoic acid |
| QVR BG DXFFF |