5-cyanobenzene-1,3-dicarboxylic acid structure
|
Common Name | 5-cyanobenzene-1,3-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 23341-13-1 | Molecular Weight | 191.14000 | |
| Density | 1.57g/cm3 | Boiling Point | 454.6ºC at 760 mmHg | |
| Molecular Formula | C9H5NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 228.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-cyanobenzene-1,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 454.6ºC at 760 mmHg |
| Molecular Formula | C9H5NO4 |
| Molecular Weight | 191.14000 |
| Flash Point | 228.7ºC |
| Exact Mass | 191.02200 |
| PSA | 98.39000 |
| LogP | 0.95468 |
| Vapour Pressure | 4.69E-09mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | YKADUTAIRWMMFI-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(C(=O)O)cc(C(=O)O)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2926909090 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Luminescence and magnetic properties of three metal–organic frameworks based on the 5-(1H-tetrazol-5-yl) isophthalic acid ligand Calahorro A, et al.
CrystEngComm 15(38) , 7636-7639, (2013)
|
| Trimesic acid mononitril |
| 5-Cyano-1,3-benzenedicarboxylic acid |
| 5-Cyan-isophthalsaeure |
| H2CyIPT |
| 5-Cyanoisophthalic acid |