1H-Benzotriazole,4,5,6,7-tetrachloro- structure
|
Common Name | 1H-Benzotriazole,4,5,6,7-tetrachloro- | ||
|---|---|---|---|---|
| CAS Number | 2338-10-5 | Molecular Weight | 256.90400 | |
| Density | 1.887g/cm3 | Boiling Point | 414.4ºC at 760 mmHg | |
| Molecular Formula | C6HCl4N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.9ºC | |
| Name | 4,5,6,7-tetrachloro-2H-benzotriazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.887g/cm3 |
|---|---|
| Boiling Point | 414.4ºC at 760 mmHg |
| Molecular Formula | C6HCl4N3 |
| Molecular Weight | 256.90400 |
| Flash Point | 236.9ºC |
| Exact Mass | 254.89200 |
| PSA | 41.57000 |
| LogP | 3.57150 |
| Vapour Pressure | 4.46E-07mmHg at 25°C |
| Index of Refraction | 1.729 |
| InChIKey | ZNJPBNVCQVDOJX-UHFFFAOYSA-N |
| SMILES | Clc1c(Cl)c(Cl)c2n[nH]nc2c1Cl |
|
~%
1H-Benzotriazol... CAS#:2338-10-5 |
| Literature: Rangadurai, A.; Srinivasan, V. S.; Thiagarajan, V.; Venkatasubramanian, N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 10 p. 898 - 903 |
|
~%
1H-Benzotriazol... CAS#:2338-10-5 |
| Literature: Wiley et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 5102,5104 |
|
~%
1H-Benzotriazol... CAS#:2338-10-5 |
| Literature: Wiley; Hussung Journal of the American Chemical Society, 1957 , vol. 79, p. 4395,4399 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,5,6,7-Tetrachloro-1H-1,2,3-benzotriazole |
| 4,5,6,7-Tetrachlor-1H-benzotriazol |
| 4,5,6,7-tetrachloro-1H-benzotriazole |
| 1h-1,2,3-benzotriazole,4,5,6,7-tetrachloro |
| TCBT |