1,2-Dichloro-4-fluoro-5-nitrobenzene structure
|
Common Name | 1,2-Dichloro-4-fluoro-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 2339-78-8 | Molecular Weight | 209.990 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 247.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C6H2Cl2FNO2 | Melting Point | 17 °C(lit.) | |
| MSDS | USA | Flash Point | 115.3±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,2-dichloro-4-fluoro-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 247.0±0.0 °C at 760 mmHg |
| Melting Point | 17 °C(lit.) |
| Molecular Formula | C6H2Cl2FNO2 |
| Molecular Weight | 209.990 |
| Flash Point | 115.3±25.9 °C |
| Exact Mass | 208.944656 |
| PSA | 45.82000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±0.4 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | FXOCDIKCKFOUDE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1F |
| Storage condition | Room temperature. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2904909090 |
|
~%
1,2-Dichloro-4-... CAS#:2339-78-8 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 94,95, 97 |
|
~%
1,2-Dichloro-4-... CAS#:2339-78-8 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 42, # SUPPL. 1 p. S27-S29 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Combinatorial libraries of bis-heterocyclic compounds with skeletal diversity.
J. Comb. Chem. 10(6) , 923-33, (2008) Combinatorial solid-phase synthesis of bis-heterocyclic compounds, characterized by the presence of two heterocyclic cores connected by a spacer of variable length/structure, provided structurally het... |
|
|
Measurement of dipolar couplings in partially oriented molecules by local field NMR spectroscopy with low-power decoupling. Marjanska M, et al.
J. Magn. Reson. 158(1) , 52-59, (2002)
|
|
|
Selective excitation in dipole coupled systems. Walls JD, et al.
Chem. Phys. Lett. 357(3) , 241-8, (2002)
|
| 4,5-dichloro-2-fluoronitrobenzene |
| 2-fluoro-4,5-dichloronitrobenzene |
| WNR CG DG FF |
| 1,2-dichloro-5-fluoro-4-nitrobenzene |
| 3,4-dichloro-6-fluoronitrobenzene |
| MFCD00075330 |
| 4,5-dichloro-1-fluoro-2-nitrobenzene |
| 1,2-Dichloro-4-fluoro-5-nitrobenzene |
| Benzene, 1,2-dichloro-4-fluoro-5-nitro- |
| Benzene,1,2-dichloro-4-fluoro-5-nitro |
| 1,2-dichloro-4-fluoro-5-nitro-benzene |